C12H18O6S2 — CID 125028693
[(1S,2R,4R,5R,6R,7S,8R,10R)-10-methylsulfonyloxy-5-tetracyclo[5.2.1.02,6.04,8]decanyl] methanesulfonate (PubChem CID 125028693) has the molecular formula C12H18O6S2 and a molecular weight of 322.40 g/mol. Its IUPAC name is [(1S,2R,4R,5R,6R,7S,8R,10R)-10-methylsulfonyloxy-5-tetracyclo[5.2.1.02,6.04,8]decanyl] methanesulfonate.
| Compound Name | [(1S,2R,4R,5R,6R,7S,8R,10R)-10-methylsulfonyloxy-5-tetracyclo[5.2.1.02,6.04,8]decanyl] methanesulfonate |
|---|---|
| PubChem CID | 125028693 |
| Molecular Formula | C12H18O6S2 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | [(1S,2R,4R,5R,6R,7S,8R,10R)-10-methylsulfonyloxy-5-tetracyclo[5.2.1.02,6.04,8]decanyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1[C@H]2C[C@@H]3[C@H]4C[C@H]2[C@@H]([C@@H]4OS(C)(=O)=O)[C@H]31 |
| InChI | InChI=1S/C12H18O6S2/c1-19(13,14)17-11-7-3-6-8-4-5(7)10(9(6)11)12(8)18-20(2,15)16/h5-12H,3-4H2,1-2H3/t5-,6-,7-,8+,9-,10+,11-,12-/m1/s1 |
| InChIKey | URPSAOJPGIYZCX-JGZJKUPSSA-N |
| XLogP | 0.21 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|