C12H18O7S2 — CID 131865054
[(1R,2S,4R,5S)-4-methylsulfonyloxy-9-oxo-2-adamantyl] methanesulfonate (PubChem CID 131865054) has the molecular formula C12H18O7S2 and a molecular weight of 338.40 g/mol. Its IUPAC name is [(1R,2S,4R,5S)-4-methylsulfonyloxy-9-oxo-2-adamantyl] methanesulfonate.
| Compound Name | [(1R,2S,4R,5S)-4-methylsulfonyloxy-9-oxo-2-adamantyl] methanesulfonate |
|---|---|
| PubChem CID | 131865054 |
| Molecular Formula | C12H18O7S2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | [(1R,2S,4R,5S)-4-methylsulfonyloxy-9-oxo-2-adamantyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1C2CC3C[C@@H]1C(=O)[C@H](C3)[C@H]2OS(C)(=O)=O |
| InChI | InChI=1S/C12H18O7S2/c1-20(14,15)18-11-7-3-6-4-8(10(7)13)12(9(11)5-6)19-21(2,16)17/h6-9,11-12H,3-5H2,1-2H3/t6?,7-,8+,9?,11+,12- |
| InChIKey | GJIDHSLSTFWFTD-HXXFJEJJSA-N |
| XLogP | -0.08 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|