C8H12O4S — CID 165350844
[(1S,2R,5S)-6-oxo-2-bicyclo[3.2.0]heptanyl] methanesulfonate (PubChem CID 165350844) has the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. Its IUPAC name is [(1S,2R,5S)-6-oxo-2-bicyclo[3.2.0]heptanyl] methanesulfonate.
| Compound Name | [(1S,2R,5S)-6-oxo-2-bicyclo[3.2.0]heptanyl] methanesulfonate |
|---|---|
| PubChem CID | 165350844 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | [(1S,2R,5S)-6-oxo-2-bicyclo[3.2.0]heptanyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1CC[C@@H]2C(=O)C[C@@H]21 |
| InChI | InChI=1S/C8H12O4S/c1-13(10,11)12-8-3-2-5-6(8)4-7(5)9/h5-6,8H,2-4H2,1H3/t5-,6-,8+/m0/s1 |
| InChIKey | BXSNFBQKNSESCF-VMHSAVOQSA-N |
| XLogP | 0.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|