C19H26O3S — CID 139797052
(5-methyl-4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-enyl) methanesulfonate (PubChem CID 139797052) has the molecular formula C19H26O3S and a molecular weight of 334.48 g/mol. Its IUPAC name is (5-methyl-4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-enyl) methanesulfonate.
| Compound Name | (5-methyl-4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-enyl) methanesulfonate |
|---|---|
| PubChem CID | 139797052 |
| Molecular Formula | C19H26O3S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (5-methyl-4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-enyl) methanesulfonate |
| SMILES | CC1C2CC(C1OS(C)(=O)=O)C1C3CC(C4C5C=CC(C5)C34)C21 |
| InChI | InChI=1S/C19H26O3S/c1-8-11-6-14(19(8)22-23(2,20)21)18-13-7-12(17(11)18)15-9-3-4-10(5-9)16(13)15/h3-4,8-19H,5-7H2,1-2H3 |
| InChIKey | CTWLHNWBMJRTDN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|