C18H24O7S2 — CID 139828956
(5-methylsulfonyloxy-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-en-4-yl) methanesulfonate (PubChem CID 139828956) has the molecular formula C18H24O7S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is (5-methylsulfonyloxy-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-en-4-yl) methanesulfonate.
| Compound Name | (5-methylsulfonyloxy-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-en-4-yl) methanesulfonate |
|---|---|
| PubChem CID | 139828956 |
| Molecular Formula | C18H24O7S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | (5-methylsulfonyloxy-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-en-4-yl) methanesulfonate |
| SMILES | CS(=O)(=O)OC1C2CC(C1OS(C)(=O)=O)C1C3OC(C4C5C=CC(C5)C34)C21 |
| InChI | InChI=1S/C18H24O7S2/c1-26(19,20)24-15-9-6-10(16(15)25-27(2,21)22)14-13(9)17-11-7-3-4-8(5-7)12(11)18(14)23-17/h3-4,7-18H,5-6H2,1-2H3 |
| InChIKey | JYILAAJVSIEMRW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|