C23H27NO2 — CID 139828937
16-methoxy-19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-ene-15-carbonitrile (PubChem CID 139828937) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is 16-methoxy-19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-ene-15-carbonitrile.
| Compound Name | 16-methoxy-19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-ene-15-carbonitrile |
|---|---|
| PubChem CID | 139828937 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 16-methoxy-19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-ene-15-carbonitrile |
| SMILES | COC1C(C#N)C2CC1C1C3OC(C21)C1C2CC(C4C5C=CC(C5)C24)C31 |
| InChI | InChI=1S/C23H27NO2/c1-25-21-13-5-10(14(21)7-24)17-20(13)23-19-12-6-11(18(19)22(17)26-23)15-8-2-3-9(4-8)16(12)15/h2-3,8-23H,4-6H2,1H3 |
| InChIKey | KKZSRTRLWPPGMV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|