C19H25N — CID 139711732
5-cyclohexyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carbonitrile (PubChem CID 139711732) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 5-cyclohexyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carbonitrile.
| Compound Name | 5-cyclohexyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carbonitrile |
|---|---|
| PubChem CID | 139711732 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 5-cyclohexyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carbonitrile |
| SMILES | N#CC1C2CC(C1C1CCCCC1)C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C19H25N/c20-10-16-14-9-15(17(16)11-4-2-1-3-5-11)19-13-7-6-12(8-13)18(14)19/h6-7,11-19H,1-5,8-9H2 |
| InChIKey | VFHMPWMDZNGMEP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|