C28H36O5 — CID 139828982
15-O-tert-butyl 16-O-methyl 19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-ene-15,16-dicarboxylate (PubChem CID 139828982) has the molecular formula C28H36O5 and a molecular weight of 452.59 g/mol. Its IUPAC name is 15-O-tert-butyl 16-O-methyl 19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-ene-15,16-dicarboxylate.
| Compound Name | 15-O-tert-butyl 16-O-methyl 19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-ene-15,16-dicarboxylate |
|---|---|
| PubChem CID | 139828982 |
| Molecular Formula | C28H36O5 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 15-O-tert-butyl 16-O-methyl 19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-ene-15,16-dicarboxylate |
| SMILES | COC(=O)C1C2CC(C1C(=O)OC(C)(C)C)C1C3OC(C21)C1C2CC(C4C5C=CC(C5)C24)C31 |
| InChI | InChI=1S/C28H36O5/c1-28(2,3)33-27(30)23-15-9-14(22(23)26(29)31-4)20-21(15)25-19-13-8-12(18(19)24(20)32-25)16-10-5-6-11(7-10)17(13)16/h5-6,10-25H,7-9H2,1-4H3 |
| InChIKey | ZRQIERDELZHQPZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|