C22H28O4S — CID 139828976
19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-en-15-yl methanesulfonate (PubChem CID 139828976) has the molecular formula C22H28O4S and a molecular weight of 388.53 g/mol. Its IUPAC name is 19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-en-15-yl methanesulfonate.
| Compound Name | 19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-en-15-yl methanesulfonate |
|---|---|
| PubChem CID | 139828976 |
| Molecular Formula | C22H28O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-en-15-yl methanesulfonate |
| SMILES | CS(=O)(=O)OC1CC2CC1C1C3OC(C21)C1C2CC(C4C5C=CC(C5)C24)C31 |
| InChI | InChI=1S/C22H28O4S/c1-27(23,24)26-14-6-10-5-11(14)18-17(10)21-19-12-7-13(20(19)22(18)25-21)16-9-3-2-8(4-9)15(12)16/h2-3,8-22H,4-7H2,1H3 |
| InChIKey | IGIKQZMSGJMVSS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|