C23H34O — CID 139797204
11-methyl-12-[(2-methylpropan-2-yl)oxymethyl]hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-4-ene (PubChem CID 139797204) has the molecular formula C23H34O and a molecular weight of 326.52 g/mol. Its IUPAC name is 11-methyl-12-[(2-methylpropan-2-yl)oxymethyl]hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-4-ene.
| Compound Name | 11-methyl-12-[(2-methylpropan-2-yl)oxymethyl]hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-4-ene |
|---|---|
| PubChem CID | 139797204 |
| Molecular Formula | C23H34O |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | 11-methyl-12-[(2-methylpropan-2-yl)oxymethyl]hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-4-ene |
| SMILES | CC1C(COC(C)(C)C)C2CC1C1C3CC(C4C5C=CC(C5)C34)C21 |
| InChI | InChI=1S/C23H34O/c1-11-14-8-15(18(11)10-24-23(2,3)4)22-17-9-16(21(14)22)19-12-5-6-13(7-12)20(17)19/h5-6,11-22H,7-10H2,1-4H3 |
| InChIKey | VMWZLSDLICBNTP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|