C16H24O2 — CID 59748363
9,10-bis(methoxymethyl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 59748363) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 9,10-bis(methoxymethyl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | 9,10-bis(methoxymethyl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 59748363 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 9,10-bis(methoxymethyl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | COCC1C(COC)C2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C16H24O2/c1-17-7-13-11-6-12(14(13)8-18-2)16-10-4-3-9(5-10)15(11)16/h3-4,9-16H,5-8H2,1-2H3 |
| InChIKey | HTAYZQOMCNXYKX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|