C19H27F3O2 — CID 173486772
(2S)-2-[[(10Z)-10-ethylidene-5-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methoxy]-1,1,1-trifluoropropan-2-ol (PubChem CID 173486772) has the molecular formula C19H27F3O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is (2S)-2-[[(10Z)-10-ethylidene-5-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methoxy]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-2-[[(10Z)-10-ethylidene-5-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methoxy]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 173486772 |
| Molecular Formula | C19H27F3O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (2S)-2-[[(10Z)-10-ethylidene-5-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methoxy]-1,1,1-trifluoropropan-2-ol |
| SMILES | C/C=C1/CC2CC1C1C3CC(C(C)C3CO[C@](C)(O)C(F)(F)F)C21 |
| InChI | InChI=1S/C19H27F3O2/c1-4-10-5-11-6-13(10)17-14-7-12(16(11)17)9(2)15(14)8-24-18(3,23)19(20,21)22/h4,9,11-17,23H,5-8H2,1-3H3/b10-4-/t9?,11?,12?,13?,14?,15?,16?,17?,18-/m0/s1 |
| InChIKey | OSSRFHQKDZDZCA-IFTDWWGCSA-N |
| XLogP | 4.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|