C27H40O14S2 — CID 145412104
methyl methanesulfonate;tetramethyl 3-methylsulfonyloxypentacyclo[10.2.1.15,8.02,11.04,9]hexadecane-6,7,13,14-tetracarboxylate (PubChem CID 145412104) has the molecular formula C27H40O14S2 and a molecular weight of 652.74 g/mol. Its IUPAC name is methyl methanesulfonate;tetramethyl 3-methylsulfonyloxypentacyclo[10.2.1.15,8.02,11.04,9]hexadecane-6,7,13,14-tetracarboxylate.
| Compound Name | methyl methanesulfonate;tetramethyl 3-methylsulfonyloxypentacyclo[10.2.1.15,8.02,11.04,9]hexadecane-6,7,13,14-tetracarboxylate |
|---|---|
| PubChem CID | 145412104 |
| Molecular Formula | C27H40O14S2 |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.19 |
| IUPAC Name | methyl methanesulfonate;tetramethyl 3-methylsulfonyloxypentacyclo[10.2.1.15,8.02,11.04,9]hexadecane-6,7,13,14-tetracarboxylate |
| SMILES | COC(=O)C1C2CC(C1C(=O)OC)C1C2CC2C3CC(C(C(=O)OC)C3C(=O)OC)C2C1OS(C)(=O)=O.COS(C)(=O)=O |
| InChI | InChI=1S/C25H34O11S.C2H6O3S/c1-32-22(26)17-11-7-13(19(17)24(28)34-3)15-9(11)6-10-12-8-14(16(10)21(15)36-37(5,30)31)20(25(29)35-4)18(12)23(27)33-2;1-5-6(2,3)4/h9-21H,6-8H2,1-5H3;1-2H3 |
| InChIKey | DDWHEENYMSUXCM-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 191.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|