C23H26F2O9 — CID 160790523
methyl (1R,2R,4S,5S,6R)-2-benzoyloxy-6-fluoro-4-hydroxybicyclo[3.1.0]hexane-6-carboxylate;methyl (1R,2R,4S,5S)-6-fluoro-2,4-dihydroxybicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 160790523) has the molecular formula C23H26F2O9 and a molecular weight of 484.45 g/mol. Its IUPAC name is methyl (1R,2R,4S,5S,6R)-2-benzoyloxy-6-fluoro-4-hydroxybicyclo[3.1.0]hexane-6-carboxylate;methyl (1R,2R,4S,5S)-6-fluoro-2,4-dihydroxybicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | methyl (1R,2R,4S,5S,6R)-2-benzoyloxy-6-fluoro-4-hydroxybicyclo[3.1.0]hexane-6-carboxylate;methyl (1R,2R,4S,5S)-6-fluoro-2,4-dihydroxybicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 160790523 |
| Molecular Formula | C23H26F2O9 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | methyl (1R,2R,4S,5S,6R)-2-benzoyloxy-6-fluoro-4-hydroxybicyclo[3.1.0]hexane-6-carboxylate;methyl (1R,2R,4S,5S)-6-fluoro-2,4-dihydroxybicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | COC(=O)C1(F)[C@@H]2[C@H]1[C@@H](O)C[C@H]2O.COC(=O)[C@]1(F)[C@@H]2[C@H]1[C@@H](O)C[C@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H15FO5.C8H11FO4/c1-20-14(19)15(16)11-9(17)7-10(12(11)15)21-13(18)8-5-3-2-4-6-8;1-13-7(12)8(9)5-3(10)2-4(11)6(5)8/h2-6,9-12,17H,7H2,1H3;3-6,10-11H,2H2,1H3/t9-,10+,11+,12-,15+;3-,4+,5+,6-,8?/m0./s1 |
| InChIKey | SBTRUEBTTQGZRN-NCZPNDKXSA-N |
| XLogP | 0.34 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|