C18H20O3 — CID 98509808
[(1R,2S,3S,5R,7S,8S,9R)-3-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] benzoate (PubChem CID 98509808) has the molecular formula C18H20O3 and a molecular weight of 284.35 g/mol. Its IUPAC name is [(1R,2S,3S,5R,7S,8S,9R)-3-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] benzoate.
| Compound Name | [(1R,2S,3S,5R,7S,8S,9R)-3-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] benzoate |
|---|---|
| PubChem CID | 98509808 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [(1R,2S,3S,5R,7S,8S,9R)-3-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] benzoate |
| SMILES | C[C@@]12O[C@@H]1C[C@H]1[C@@H]3C[C@H](C[C@H]3OC(=O)c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C18H20O3/c1-18-15(21-18)9-13-12-7-11(16(13)18)8-14(12)20-17(19)10-5-3-2-4-6-10/h2-6,11-16H,7-9H2,1H3/t11-,12+,13+,14-,15-,16+,18-/m1/s1 |
| InChIKey | ILJDPEMUJYUKMG-QEGFHOJKSA-N |
| XLogP | 3.05 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|