C17H18O3 — CID 98509794
[(1R,2R,3R,5R,7R,8R,9S)-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] benzoate (PubChem CID 98509794) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is [(1R,2R,3R,5R,7R,8R,9S)-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] benzoate.
| Compound Name | [(1R,2R,3R,5R,7R,8R,9S)-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] benzoate |
|---|---|
| PubChem CID | 98509794 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [(1R,2R,3R,5R,7R,8R,9S)-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] benzoate |
| SMILES | O=C(O[C@H]1C[C@H]2C[C@@H]1[C@H]1C[C@H]3O[C@@H]3[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C17H18O3/c18-17(9-4-2-1-3-5-9)20-13-7-10-6-11(13)12-8-14-16(19-14)15(10)12/h1-5,10-16H,6-8H2/t10-,11-,12-,13+,14-,15-,16+/m1/s1 |
| InChIKey | DDGVTCZIJXAZOT-ZPHYEXBNSA-N |
| XLogP | 2.66 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|