C16H14I2O6 — CID 117069745
dimethyl 5,12-dihydroxy-6,11-diiodopentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-diene-8,9-dicarboxylate (PubChem CID 117069745) has the molecular formula C16H14I2O6 and a molecular weight of 556.09 g/mol. Its IUPAC name is dimethyl 5,12-dihydroxy-6,11-diiodopentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-diene-8,9-dicarboxylate.
| Compound Name | dimethyl 5,12-dihydroxy-6,11-diiodopentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-diene-8,9-dicarboxylate |
|---|---|
| PubChem CID | 117069745 |
| Molecular Formula | C16H14I2O6 |
| Molecular Weight | 556.09 g/mol |
| Exact Mass | 555.89 |
| IUPAC Name | dimethyl 5,12-dihydroxy-6,11-diiodopentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-diene-8,9-dicarboxylate |
| SMILES | COC(=O)C12C3C(O)=C(I)C4C3C3C(C(O)=C(I)C31)C42C(=O)OC |
| InChI | InChI=1S/C16H14I2O6/c1-23-13(21)15-5-3-4-6(10(18)11(19)7(4)15)16(15,14(22)24-2)8(3)12(20)9(5)17/h3-8,19-20H,1-2H3 |
| InChIKey | JYIXQOLTEARTOK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.09 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|