C14H15BrO2S2 — CID 99723067
methyl (2'S,3'S,6'S,7'R)-1'-bromospiro[1,3-dithiolane-2,10'-pentacyclo[4.4.0.02,5.03,8.04,7]decane]-4'-carboxylate (PubChem CID 99723067) has the molecular formula C14H15BrO2S2 and a molecular weight of 359.31 g/mol. Its IUPAC name is methyl (2'S,3'S,6'S,7'R)-1'-bromospiro[1,3-dithiolane-2,10'-pentacyclo[4.4.0.02,5.03,8.04,7]decane]-4'-carboxylate.
| Compound Name | methyl (2'S,3'S,6'S,7'R)-1'-bromospiro[1,3-dithiolane-2,10'-pentacyclo[4.4.0.02,5.03,8.04,7]decane]-4'-carboxylate |
|---|---|
| PubChem CID | 99723067 |
| Molecular Formula | C14H15BrO2S2 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | methyl (2'S,3'S,6'S,7'R)-1'-bromospiro[1,3-dithiolane-2,10'-pentacyclo[4.4.0.02,5.03,8.04,7]decane]-4'-carboxylate |
| SMILES | COC(=O)C12C3[C@@H]4[C@H]1C1CC5(SCCS5)C4(Br)[C@H]3[C@H]12 |
| InChI | InChI=1S/C14H15BrO2S2/c1-17-11(16)13-6-5-4-12(18-2-3-19-12)14(15)9(6)8(13)10(14)7(5)13/h5-10H,2-4H2,1H3/t5?,6-,7+,8?,9-,10-,13?,14?/m0/s1 |
| InChIKey | QXEYKUYDOGJKCT-AEICMFGUSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|