C17H20F4O5S — CID 144726831
ethane;methyl 1-(3-fluoro-2-methylphenyl)-3-(trifluoromethylsulfonyloxy)cyclopent-2-ene-1-carboxylate (PubChem CID 144726831) has the molecular formula C17H20F4O5S and a molecular weight of 412.40 g/mol. Its IUPAC name is ethane;methyl 1-(3-fluoro-2-methylphenyl)-3-(trifluoromethylsulfonyloxy)cyclopent-2-ene-1-carboxylate.
| Compound Name | ethane;methyl 1-(3-fluoro-2-methylphenyl)-3-(trifluoromethylsulfonyloxy)cyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 144726831 |
| Molecular Formula | C17H20F4O5S |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | ethane;methyl 1-(3-fluoro-2-methylphenyl)-3-(trifluoromethylsulfonyloxy)cyclopent-2-ene-1-carboxylate |
| SMILES | CC.COC(=O)C1(c2cccc(F)c2C)C=C(OS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H14F4O5S.C2H6/c1-9-11(4-3-5-12(9)16)14(13(20)23-2)7-6-10(8-14)24-25(21,22)15(17,18)19;1-2/h3-5,8H,6-7H2,1-2H3;1-2H3 |
| InChIKey | MZAPEHPRTUFGOK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|