C28H36O5S — CID 125032511
[(3R,5S,8S,9R,10S,13R,14R)-17-acetyl-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate (PubChem CID 125032511) has the molecular formula C28H36O5S and a molecular weight of 484.66 g/mol. Its IUPAC name is [(3R,5S,8S,9R,10S,13R,14R)-17-acetyl-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3R,5S,8S,9R,10S,13R,14R)-17-acetyl-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 125032511 |
| Molecular Formula | C28H36O5S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | [(3R,5S,8S,9R,10S,13R,14R)-17-acetyl-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate |
| SMILES | CC(=O)C1=CC[C@@H]2[C@@H]3CC[C@H]4C[C@H](OS(=O)(=O)c5ccc(C)cc5)CC[C@]4(C)[C@@H]3C(=O)C[C@@]12C |
| InChI | InChI=1S/C28H36O5S/c1-17-5-8-21(9-6-17)34(31,32)33-20-13-14-27(3)19(15-20)7-10-22-24-12-11-23(18(2)29)28(24,4)16-25(30)26(22)27/h5-6,8-9,11,19-20,22,24,26H,7,10,12-16H2,1-4H3/t19-,20+,22-,24+,26-,27-,28-/m0/s1 |
| InChIKey | YHJLHWNJZIEBNI-MSUUFCKFSA-N |
| XLogP | 5.42 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|