C21H28O7S — CID 99576169
[(1S,2S,4R,9S,12S,13S,16S,18S)-9,13-dimethyl-6,11-dioxo-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-7-en-16-yl] hydrogen sulfate (PubChem CID 99576169) has the molecular formula C21H28O7S and a molecular weight of 424.52 g/mol. Its IUPAC name is [(1S,2S,4R,9S,12S,13S,16S,18S)-9,13-dimethyl-6,11-dioxo-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-7-en-16-yl] hydrogen sulfate.
| Compound Name | [(1S,2S,4R,9S,12S,13S,16S,18S)-9,13-dimethyl-6,11-dioxo-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-7-en-16-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 99576169 |
| Molecular Formula | C21H28O7S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [(1S,2S,4R,9S,12S,13S,16S,18S)-9,13-dimethyl-6,11-dioxo-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-7-en-16-yl] hydrogen sulfate |
| SMILES | C[C@]12CC[C@H](OS(=O)(=O)O)C[C@@H]1CC[C@@H]1[C@@H]2C(=O)C[C@]2(C)C3=CC(=O)O[C@@H]3C[C@@H]12 |
| InChI | InChI=1S/C21H28O7S/c1-20-6-5-12(28-29(24,25)26)7-11(20)3-4-13-14-8-17-15(9-18(23)27-17)21(14,2)10-16(22)19(13)20/h9,11-14,17,19H,3-8,10H2,1-2H3,(H,24,25,26)/t11-,12-,13-,14-,17+,19+,20-,21-/m0/s1 |
| InChIKey | VZDKYIUFBGYSPG-WLCSKYDNSA-N |
| XLogP | 2.86 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|