C29H53O4P — CID 10435946
[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] dimethyl phosphate (PubChem CID 10435946) has the molecular formula C29H53O4P and a molecular weight of 496.71 g/mol. Its IUPAC name is [(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] dimethyl phosphate.
| Compound Name | [(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] dimethyl phosphate |
|---|---|
| PubChem CID | 10435946 |
| Molecular Formula | C29H53O4P |
| Molecular Weight | 496.71 g/mol |
| Exact Mass | 496.37 |
| IUPAC Name | [(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] dimethyl phosphate |
| SMILES | COP(=O)(OC)OC1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H53O4P/c1-20(2)9-8-10-21(3)25-13-14-26-24-12-11-22-19-23(33-34(30,31-6)32-7)15-17-28(22,4)27(24)16-18-29(25,26)5/h20-27H,8-19H2,1-7H3/t21-,22+,23?,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | IRBGIENOKVPOQW-UNOJTMJMSA-N |
| XLogP | 8.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.71 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|