C31H57O4P — CID 11071446
[(3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] diethyl phosphate (PubChem CID 11071446) has the molecular formula C31H57O4P and a molecular weight of 524.77 g/mol. Its IUPAC name is [(3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] diethyl phosphate.
| Compound Name | [(3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] diethyl phosphate |
|---|---|
| PubChem CID | 11071446 |
| Molecular Formula | C31H57O4P |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 524.40 |
| IUPAC Name | [(3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C31H57O4P/c1-8-33-36(32,34-9-2)35-25-17-19-30(6)24(21-25)13-14-26-28-16-15-27(23(5)12-10-11-22(3)4)31(28,7)20-18-29(26)30/h22-29H,8-21H2,1-7H3/t23-,24+,25+,26+,27-,28+,29+,30+,31-/m1/s1 |
| InChIKey | QDFUXEJCFMYYIU-PZSQHWECSA-N |
| XLogP | 9.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|