C25H34N2O5 — CID 59810022
CID 59810022 (PubChem CID 59810022) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol.
| Compound Name | CID 59810022 |
|---|---|
| PubChem CID | 59810022 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | — |
| SMILES | CN(C)/N=C1\C[C@@]2(C)[C@@H](CC[C@@]23OCOC32COCO2)[C@@H]2CCC3=CC(=O)C=C[C@]3(C)[C@@H]12 |
| InChI | InChI=1S/C25H34N2O5/c1-22-9-7-17(28)11-16(22)5-6-18-19-8-10-24(25(32-15-30-24)13-29-14-31-25)23(19,2)12-20(21(18)22)26-27(3)4/h7,9,11,18-19,21H,5-6,8,10,12-15H2,1-4H3/b26-20+/t18-,19-,21+,22-,23-,24+,25?/m0/s1 |
| InChIKey | PAXOEGKVJNPBQX-MLKIWOKFSA-N |
| XLogP | 3.27 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|