C10H18O4 — CID 117168815
[2-methyl-2-(oxan-3-yl)-1,3-dioxolan-4-yl]methanol (PubChem CID 117168815) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is [2-methyl-2-(oxan-3-yl)-1,3-dioxolan-4-yl]methanol.
| Compound Name | [2-methyl-2-(oxan-3-yl)-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 117168815 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | [2-methyl-2-(oxan-3-yl)-1,3-dioxolan-4-yl]methanol |
| SMILES | CC1(C2CCCOC2)OCC(CO)O1 |
| InChI | InChI=1S/C10H18O4/c1-10(8-3-2-4-12-6-8)13-7-9(5-11)14-10/h8-9,11H,2-7H2,1H3 |
| InChIKey | ULVAMOYPDGTDBS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |