C10H14F2O3 — CID 115031854
3,3-difluoro-1-(oxan-3-yl)cyclobutane-1-carboxylic acid (PubChem CID 115031854) has the molecular formula C10H14F2O3 and a molecular weight of 220.21 g/mol. Its IUPAC name is 3,3-difluoro-1-(oxan-3-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 3,3-difluoro-1-(oxan-3-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115031854 |
| Molecular Formula | C10H14F2O3 |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 3,3-difluoro-1-(oxan-3-yl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(C2CCCOC2)CC(F)(F)C1 |
| InChI | InChI=1S/C10H14F2O3/c11-10(12)5-9(6-10,8(13)14)7-2-1-3-15-4-7/h7H,1-6H2,(H,13,14) |
| InChIKey | IBNMJNJBMPFBFX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |