C11H18O4 — CID 115028730
3-hydroxy-3-methyl-1-(oxan-3-yl)cyclobutane-1-carboxylic acid (PubChem CID 115028730) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is 3-hydroxy-3-methyl-1-(oxan-3-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 3-hydroxy-3-methyl-1-(oxan-3-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115028730 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 3-hydroxy-3-methyl-1-(oxan-3-yl)cyclobutane-1-carboxylic acid |
| SMILES | CC1(O)CC(C(=O)O)(C2CCCOC2)C1 |
| InChI | InChI=1S/C11H18O4/c1-10(14)6-11(7-10,9(12)13)8-3-2-4-15-5-8/h8,14H,2-7H2,1H3,(H,12,13) |
| InChIKey | RBFOOAQOPDMBCW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |