C10H16O4 — CID 115021943
3-hydroxy-1-(oxan-3-yl)cyclobutane-1-carboxylic acid (PubChem CID 115021943) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 3-hydroxy-1-(oxan-3-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 3-hydroxy-1-(oxan-3-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115021943 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 3-hydroxy-1-(oxan-3-yl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(C2CCCOC2)CC(O)C1 |
| InChI | InChI=1S/C10H16O4/c11-8-4-10(5-8,9(12)13)7-2-1-3-14-6-7/h7-8,11H,1-6H2,(H,12,13) |
| InChIKey | MZGSQGLBVVWOMF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |