About (3R)-oxane-3-carboxylic acid
(3R)-oxane-3-carboxylic acid (PubChem CID 42554318) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is (3R)-oxane-3-carboxylic acid.
Molecular Properties
| Compound Name | (3R)-oxane-3-carboxylic acid |
| PubChem CID | 42554318 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (3R)-oxane-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCOC1 |
| InChI | InChI=1S/C6H10O3/c7-6(8)5-2-1-3-9-4-5/h5H,1-4H2,(H,7,8)/t5-/m1/s1 |
| InChIKey | YEWPVCUHKJABMV-RXMQYKEDSA-N |
| XLogP | 0.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-oxane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-oxane-3-carboxylic acid?
The IUPAC name of (3R)-oxane-3-carboxylic acid (CID 42554318) is (3R)-oxane-3-carboxylic acid.
What is the SMILES notation for (3R)-oxane-3-carboxylic acid?
The canonical SMILES for (3R)-oxane-3-carboxylic acid is O=C(O)[C@@H]1CCCOC1.
What is the InChIKey of (3R)-oxane-3-carboxylic acid?
The InChIKey is YEWPVCUHKJABMV-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H10O3/c7-6(8)5-2-1-3-9-4-5/h5H,1-4H2,(H,7,8)/t5-/m1/s1.
What are the key properties of (3R)-oxane-3-carboxylic acid?
(3R)-oxane-3-carboxylic acid has a molecular weight of 130.14 g/mol, XLogP of 0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-oxane-3-carboxylic acid is sourced from PubChem (CID 42554318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).