(3R)-oxane-3-carboxylic acid

C6H10O3 — CID 42554318

IUPAC(3R)-oxane-3-carboxylic acid
SMILESO=C(O)[C@@H]1CCCOC1
InChIInChI=1S/C6H10O3/c7-6(8)5-2-1-3-9-4-5/h5H,1-4H2,(H,7,8)/t5-/m1/s1
InChIKeyYEWPVCUHKJABMV-RXMQYKEDSA-N
MW130.14 g/mol
LogP0.50
Rot. Bonds1

About (3R)-oxane-3-carboxylic acid

(3R)-oxane-3-carboxylic acid (PubChem CID 42554318) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is (3R)-oxane-3-carboxylic acid.

Molecular Properties

Compound Name(3R)-oxane-3-carboxylic acid
PubChem CID42554318
Molecular FormulaC6H10O3
Molecular Weight130.14 g/mol
Exact Mass130.06
IUPAC Name(3R)-oxane-3-carboxylic acid
SMILESO=C(O)[C@@H]1CCCOC1
InChIInChI=1S/C6H10O3/c7-6(8)5-2-1-3-9-4-5/h5H,1-4H2,(H,7,8)/t5-/m1/s1
InChIKeyYEWPVCUHKJABMV-RXMQYKEDSA-N
XLogP0.50
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500130.14
LogP ≤ 50.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (3R)-oxane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-oxane-3-carboxylic acid?
The IUPAC name of (3R)-oxane-3-carboxylic acid (CID 42554318) is (3R)-oxane-3-carboxylic acid.
What is the SMILES notation for (3R)-oxane-3-carboxylic acid?
The canonical SMILES for (3R)-oxane-3-carboxylic acid is O=C(O)[C@@H]1CCCOC1.
What is the InChIKey of (3R)-oxane-3-carboxylic acid?
The InChIKey is YEWPVCUHKJABMV-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H10O3/c7-6(8)5-2-1-3-9-4-5/h5H,1-4H2,(H,7,8)/t5-/m1/s1.
What are the key properties of (3R)-oxane-3-carboxylic acid?
(3R)-oxane-3-carboxylic acid has a molecular weight of 130.14 g/mol, XLogP of 0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-oxane-3-carboxylic acid is sourced from PubChem (CID 42554318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).