About oxane-3-carboxamide
oxane-3-carboxamide (PubChem CID 22714381) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is oxane-3-carboxamide.
Molecular Properties
| Compound Name | oxane-3-carboxamide |
| PubChem CID | 22714381 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | oxane-3-carboxamide |
| SMILES | NC(=O)C1CCCOC1 |
| InChI | InChI=1S/C6H11NO2/c7-6(8)5-2-1-3-9-4-5/h5H,1-4H2,(H2,7,8) |
| InChIKey | KHDGSULFSVLOPM-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze oxane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxane-3-carboxamide?
The IUPAC name of oxane-3-carboxamide (CID 22714381) is oxane-3-carboxamide.
What is the SMILES notation for oxane-3-carboxamide?
The canonical SMILES for oxane-3-carboxamide is NC(=O)C1CCCOC1.
What is the InChIKey of oxane-3-carboxamide?
The InChIKey is KHDGSULFSVLOPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c7-6(8)5-2-1-3-9-4-5/h5H,1-4H2,(H2,7,8).
What are the key properties of oxane-3-carboxamide?
oxane-3-carboxamide has a molecular weight of 129.16 g/mol, XLogP of -0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxane-3-carboxamide is sourced from PubChem (CID 22714381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).