C7H10F3NO4 — CID 172778209
oxolane-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 172778209) has the molecular formula C7H10F3NO4 and a molecular weight of 229.15 g/mol. Its IUPAC name is oxolane-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | oxolane-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 172778209 |
| Molecular Formula | C7H10F3NO4 |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | oxolane-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)C1CCOC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C5H9NO2.C2HF3O2/c6-5(7)4-1-2-8-3-4;3-2(4,5)1(6)7/h4H,1-3H2,(H2,6,7);(H,6,7) |
| InChIKey | NWXFPVQCMMBARN-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |