About oxane-3-carbonyl oxane-3-carboperoxoate
oxane-3-carbonyl oxane-3-carboperoxoate (PubChem CID 23083566) has the molecular formula C12H18O6
and a molecular weight of 258.27 g/mol. Its IUPAC name is oxane-3-carbonyl oxane-3-carboperoxoate.
Molecular Properties
| Compound Name | oxane-3-carbonyl oxane-3-carboperoxoate |
| PubChem CID | 23083566 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | oxane-3-carbonyl oxane-3-carboperoxoate |
| SMILES | O=C(OOC(=O)C1CCCOC1)C1CCCOC1 |
| InChI | InChI=1S/C12H18O6/c13-11(9-3-1-5-15-7-9)17-18-12(14)10-4-2-6-16-8-10/h9-10H,1-8H2 |
| InChIKey | IJFKEIUILIUSEV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze oxane-3-carbonyl oxane-3-carboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxane-3-carbonyl oxane-3-carboperoxoate?
The IUPAC name of oxane-3-carbonyl oxane-3-carboperoxoate (CID 23083566) is oxane-3-carbonyl oxane-3-carboperoxoate.
What is the SMILES notation for oxane-3-carbonyl oxane-3-carboperoxoate?
The canonical SMILES for oxane-3-carbonyl oxane-3-carboperoxoate is O=C(OOC(=O)C1CCCOC1)C1CCCOC1.
What is the InChIKey of oxane-3-carbonyl oxane-3-carboperoxoate?
The InChIKey is IJFKEIUILIUSEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O6/c13-11(9-3-1-5-15-7-9)17-18-12(14)10-4-2-6-16-8-10/h9-10H,1-8H2.
What are the key properties of oxane-3-carbonyl oxane-3-carboperoxoate?
oxane-3-carbonyl oxane-3-carboperoxoate has a molecular weight of 258.27 g/mol, XLogP of 0.84, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxane-3-carbonyl oxane-3-carboperoxoate is sourced from PubChem (CID 23083566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).