C12H20N2O3 — CID 71989742
N-(2-carbamoylcyclopentyl)oxane-3-carboxamide (PubChem CID 71989742) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is N-(2-carbamoylcyclopentyl)oxane-3-carboxamide.
| Compound Name | N-(2-carbamoylcyclopentyl)oxane-3-carboxamide |
|---|---|
| PubChem CID | 71989742 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | N-(2-carbamoylcyclopentyl)oxane-3-carboxamide |
| SMILES | NC(=O)C1CCCC1NC(=O)C1CCCOC1 |
| InChI | InChI=1S/C12H20N2O3/c13-11(15)9-4-1-5-10(9)14-12(16)8-3-2-6-17-7-8/h8-10H,1-7H2,(H2,13,15)(H,14,16) |
| InChIKey | UYPFOXQSCTZUAH-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |