C9H18ClNO2 — CID 117227438
2-methyl-2-(oxan-3-yl)-1,3-oxazolidine;hydrochloride (PubChem CID 117227438) has the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. Its IUPAC name is 2-methyl-2-(oxan-3-yl)-1,3-oxazolidine;hydrochloride.
| Compound Name | 2-methyl-2-(oxan-3-yl)-1,3-oxazolidine;hydrochloride |
|---|---|
| PubChem CID | 117227438 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-methyl-2-(oxan-3-yl)-1,3-oxazolidine;hydrochloride |
| SMILES | CC1(C2CCCOC2)NCCO1.Cl |
| InChI | InChI=1S/C9H17NO2.ClH/c1-9(10-4-6-12-9)8-3-2-5-11-7-8;/h8,10H,2-7H2,1H3;1H |
| InChIKey | JBKNWTIJONJEAH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |