About 2-cyclopropyl-2-methyl-1,3-oxazolidine;hydrochloride
2-cyclopropyl-2-methyl-1,3-oxazolidine;hydrochloride (PubChem CID 117227541) has the molecular formula C7H14ClNO
and a molecular weight of 163.65 g/mol. Its IUPAC name is 2-cyclopropyl-2-methyl-1,3-oxazolidine;hydrochloride.
Analyze 2-cyclopropyl-2-methyl-1,3-oxazolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-2-methyl-1,3-oxazolidine;hydrochloride?
The IUPAC name of 2-cyclopropyl-2-methyl-1,3-oxazolidine;hydrochloride (CID 117227541) is 2-cyclopropyl-2-methyl-1,3-oxazolidine;hydrochloride.
What is the SMILES notation for 2-cyclopropyl-2-methyl-1,3-oxazolidine;hydrochloride?
The canonical SMILES for 2-cyclopropyl-2-methyl-1,3-oxazolidine;hydrochloride is CC1(C2CC2)NCCO1.Cl.
What is the InChIKey of 2-cyclopropyl-2-methyl-1,3-oxazolidine;hydrochloride?
The InChIKey is XSVMQARSEHHQGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.ClH/c1-7(6-2-3-6)8-4-5-9-7;/h6,8H,2-5H2,1H3;1H.
What are the key properties of 2-cyclopropyl-2-methyl-1,3-oxazolidine;hydrochloride?
2-cyclopropyl-2-methyl-1,3-oxazolidine;hydrochloride has a molecular weight of 163.65 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-methyl-1,3-oxazolidine;hydrochloride is sourced from PubChem (CID 117227541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).