C12H25ClN2O — CID 117226234
2,5,5-trimethyl-2-piperidin-4-yl-1,3-oxazinane;hydrochloride (PubChem CID 117226234) has the molecular formula C12H25ClN2O and a molecular weight of 248.80 g/mol. Its IUPAC name is 2,5,5-trimethyl-2-piperidin-4-yl-1,3-oxazinane;hydrochloride.
| Compound Name | 2,5,5-trimethyl-2-piperidin-4-yl-1,3-oxazinane;hydrochloride |
|---|---|
| PubChem CID | 117226234 |
| Molecular Formula | C12H25ClN2O |
| Molecular Weight | 248.80 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 2,5,5-trimethyl-2-piperidin-4-yl-1,3-oxazinane;hydrochloride |
| SMILES | CC1(C)CNC(C)(C2CCNCC2)OC1.Cl |
| InChI | InChI=1S/C12H24N2O.ClH/c1-11(2)8-14-12(3,15-9-11)10-4-6-13-7-5-10;/h10,13-14H,4-9H2,1-3H3;1H |
| InChIKey | SUIDPBUMIDTIFI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.80 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |