C15H11NO2S — CID 134113894
2,4-diphenyl-1,3,5-oxathiazin-6-one (PubChem CID 134113894) has the molecular formula C15H11NO2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 2,4-diphenyl-1,3,5-oxathiazin-6-one.
| Compound Name | 2,4-diphenyl-1,3,5-oxathiazin-6-one |
|---|---|
| PubChem CID | 134113894 |
| Molecular Formula | C15H11NO2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 2,4-diphenyl-1,3,5-oxathiazin-6-one |
| SMILES | O=C1N=C(c2ccccc2)SC(c2ccccc2)O1 |
| InChI | InChI=1S/C15H11NO2S/c17-15-16-13(11-7-3-1-4-8-11)19-14(18-15)12-9-5-2-6-10-12/h1-10,14H |
| InChIKey | GHKKZXLGEZKUQQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |