C12H12N2O2 — CID 135564991
(5S)-2-cyclopropylimino-5-phenyl-1,3-oxazolidin-4-one (PubChem CID 135564991) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is (5S)-2-cyclopropylimino-5-phenyl-1,3-oxazolidin-4-one.
| Compound Name | (5S)-2-cyclopropylimino-5-phenyl-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 135564991 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (5S)-2-cyclopropylimino-5-phenyl-1,3-oxazolidin-4-one |
| SMILES | O=C1N/C(=N/C2CC2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C12H12N2O2/c15-11-10(8-4-2-1-3-5-8)16-12(14-11)13-9-6-7-9/h1-5,9-10H,6-7H2,(H,13,14,15)/t10-/m0/s1 |
| InChIKey | DNRKTAYPGADPGW-JTQLQIEISA-N |
| XLogP | 1.39 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|