C7H6NO2+ — CID 10085316
3H-2,1-benzoxazol-1-ium 1-oxide (PubChem CID 10085316) has the molecular formula C7H6NO2+ and a molecular weight of 136.13 g/mol. Its IUPAC name is 3H-2,1-benzoxazol-1-ium 1-oxide.
| Compound Name | 3H-2,1-benzoxazol-1-ium 1-oxide |
|---|---|
| PubChem CID | 10085316 |
| Molecular Formula | C7H6NO2+ |
| Molecular Weight | 136.13 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 3H-2,1-benzoxazol-1-ium 1-oxide |
| SMILES | O=[N+]1OCc2ccccc21 |
| InChI | InChI=1S/C7H6NO2/c9-8-7-4-2-1-3-6(7)5-10-8/h1-4H,5H2/q+1 |
| InChIKey | PLHYKYWLMNLEJL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.13 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |