About (4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one
(4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one (PubChem CID 90044856) has the molecular formula C10H9N2O2+
and a molecular weight of 189.19 g/mol. Its IUPAC name is (4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one.
Molecular Properties
| Compound Name | (4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one |
| PubChem CID | 90044856 |
| Molecular Formula | C10H9N2O2+ |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | (4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one |
| SMILES | O=C1/C=C\Cc2ccccc2[N+](=O)N1 |
| InChI | InChI=1S/C10H8N2O2/c13-10-7-3-5-8-4-1-2-6-9(8)12(14)11-10/h1-4,6-7H,5H2/p+1/b7-3- |
| InChIKey | WBPUPIZHUWUTQF-CLTKARDFSA-O |
| XLogP | 1.24 |
| TPSA | 49.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one?
The IUPAC name of (4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one (CID 90044856) is (4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one.
What is the SMILES notation for (4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one?
The canonical SMILES for (4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one is O=C1/C=C\Cc2ccccc2[N+](=O)N1.
What is the InChIKey of (4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one?
The InChIKey is WBPUPIZHUWUTQF-CLTKARDFSA-O. The full InChI is InChI=1S/C10H8N2O2/c13-10-7-3-5-8-4-1-2-6-9(8)12(14)11-10/h1-4,6-7H,5H2/p+1/b7-3-.
What are the key properties of (4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one?
(4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one has a molecular weight of 189.19 g/mol, XLogP of 1.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-1-oxo-2,6-dihydro-1,2-benzodiazocin-1-ium-3-one is sourced from PubChem (CID 90044856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).