C10H9NO2 — CID 91235305
6H-1,2-benzoxazocin-3-one (PubChem CID 91235305) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 6H-1,2-benzoxazocin-3-one.
| Compound Name | 6H-1,2-benzoxazocin-3-one |
|---|---|
| PubChem CID | 91235305 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 6H-1,2-benzoxazocin-3-one |
| SMILES | O=C1C=CCc2ccccc2ON1 |
| InChI | InChI=1S/C10H9NO2/c12-10-7-3-5-8-4-1-2-6-9(8)13-11-10/h1-4,6-7H,5H2,(H,11,12) |
| InChIKey | OLNVOSZSNGENOA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |