C7H7NO — CID 18782711
2,3-dihydro-1,2-benzoxazole (PubChem CID 18782711) has the molecular formula C7H7NO and a molecular weight of 121.14 g/mol. Its IUPAC name is 2,3-dihydro-1,2-benzoxazole.
| Compound Name | 2,3-dihydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 18782711 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | 2,3-dihydro-1,2-benzoxazole |
| SMILES | c1ccc2c(c1)CNO2 |
| InChI | InChI=1S/C7H7NO/c1-2-4-7-6(3-1)5-8-9-7/h1-4,8H,5H2 |
| InChIKey | GCUDWDNUXMSUIK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |