C8H8NO- — CID 87431106
2-oxido-1,3-dihydroisoindole (PubChem CID 87431106) has the molecular formula C8H8NO- and a molecular weight of 134.16 g/mol. Its IUPAC name is 2-oxido-1,3-dihydroisoindole.
| Compound Name | 2-oxido-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 87431106 |
| Molecular Formula | C8H8NO- |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 2-oxido-1,3-dihydroisoindole |
| SMILES | [O-]N1Cc2ccccc2C1 |
| InChI | InChI=1S/C8H8NO/c10-9-5-7-3-1-2-4-8(7)6-9/h1-4H,5-6H2/q-1 |
| InChIKey | QRQMKRTUXRGJAC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |