About 2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide
2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide (PubChem CID 44887623) has the molecular formula C13H13IN2
and a molecular weight of 324.17 g/mol. Its IUPAC name is 2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide.
Molecular Properties
| Compound Name | 2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide |
| PubChem CID | 44887623 |
| Molecular Formula | C13H13IN2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide |
| SMILES | [I-].c1cc[n+](N2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C13H13N2.HI/c1-4-8-14(9-5-1)15-10-12-6-2-3-7-13(12)11-15;/h1-9H,10-11H2;1H/q+1;/p-1 |
| InChIKey | BTUXOPBXGPZTMD-UHFFFAOYSA-M |
| XLogP | -1.37 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide?
The IUPAC name of 2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide (CID 44887623) is 2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide.
What is the SMILES notation for 2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide?
The canonical SMILES for 2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide is [I-].c1cc[n+](N2Cc3ccccc3C2)cc1.
What is the InChIKey of 2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide?
The InChIKey is BTUXOPBXGPZTMD-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H13N2.HI/c1-4-8-14(9-5-1)15-10-12-6-2-3-7-13(12)11-15;/h1-9H,10-11H2;1H/q+1;/p-1.
What are the key properties of 2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide?
2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide has a molecular weight of 324.17 g/mol, XLogP of -1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-1-ium-1-yl-1,3-dihydroisoindole iodide is sourced from PubChem (CID 44887623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).