C14H14N2 — CID 22900857
N-phenyl-1,3-dihydroisoindol-2-amine (PubChem CID 22900857) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N-phenyl-1,3-dihydroisoindol-2-amine.
| Compound Name | N-phenyl-1,3-dihydroisoindol-2-amine |
|---|---|
| PubChem CID | 22900857 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-phenyl-1,3-dihydroisoindol-2-amine |
| SMILES | c1ccc(NN2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C14H14N2/c1-2-8-14(9-3-1)15-16-10-12-6-4-5-7-13(12)11-16/h1-9,15H,10-11H2 |
| InChIKey | BHGXBDIJFTZVHE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |