About ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine
ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine (PubChem CID 171627514) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine.
Molecular Properties
| Compound Name | ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine |
| PubChem CID | 171627514 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine |
| SMILES | CC.CNN1CCc2ccccc2C1 |
| InChI | InChI=1S/C10H14N2.C2H6/c1-11-12-7-6-9-4-2-3-5-10(9)8-12;1-2/h2-5,11H,6-8H2,1H3;1-2H3 |
| InChIKey | UFKOGRAQLHXREB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine?
The IUPAC name of ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine (CID 171627514) is ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine.
What is the SMILES notation for ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine?
The canonical SMILES for ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine is CC.CNN1CCc2ccccc2C1.
What is the InChIKey of ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine?
The InChIKey is UFKOGRAQLHXREB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.C2H6/c1-11-12-7-6-9-4-2-3-5-10(9)8-12;1-2/h2-5,11H,6-8H2,1H3;1-2H3.
What are the key properties of ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine?
ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine has a molecular weight of 192.31 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-3,4-dihydro-1H-isoquinolin-2-amine is sourced from PubChem (CID 171627514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).