C11H16BNO2 — CID 149205156
N-methyl-2-[(5-methyl-3H-2,1-benzoxaborol-1-yl)oxy]ethanamine (PubChem CID 149205156) has the molecular formula C11H16BNO2 and a molecular weight of 205.07 g/mol. Its IUPAC name is N-methyl-2-[(5-methyl-3H-2,1-benzoxaborol-1-yl)oxy]ethanamine.
| Compound Name | N-methyl-2-[(5-methyl-3H-2,1-benzoxaborol-1-yl)oxy]ethanamine |
|---|---|
| PubChem CID | 149205156 |
| Molecular Formula | C11H16BNO2 |
| Molecular Weight | 205.07 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-methyl-2-[(5-methyl-3H-2,1-benzoxaborol-1-yl)oxy]ethanamine |
| SMILES | CNCCOB1OCc2cc(C)ccc21 |
| InChI | InChI=1S/C11H16BNO2/c1-9-3-4-11-10(7-9)8-15-12(11)14-6-5-13-2/h3-4,7,13H,5-6,8H2,1-2H3 |
| InChIKey | XFLNXZRLAHYLAK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.07 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|