C17H13BFNO3 — CID 157368975
4-fluoro-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-methylquinoline (PubChem CID 157368975) has the molecular formula C17H13BFNO3 and a molecular weight of 309.11 g/mol. Its IUPAC name is 4-fluoro-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-methylquinoline.
| Compound Name | 4-fluoro-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-methylquinoline |
|---|---|
| PubChem CID | 157368975 |
| Molecular Formula | C17H13BFNO3 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 4-fluoro-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-methylquinoline |
| SMILES | Cc1ccc2nc(Oc3ccc4c(c3)COB4O)cc(F)c2c1 |
| InChI | InChI=1S/C17H13BFNO3/c1-10-2-5-16-13(6-10)15(19)8-17(20-16)23-12-3-4-14-11(7-12)9-22-18(14)21/h2-8,21H,9H2,1H3 |
| InChIKey | BJNHWFYTIQXAQM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|