C17H11BF3NO3 — CID 157109365
2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-5-(trifluoromethyl)quinoline (PubChem CID 157109365) has the molecular formula C17H11BF3NO3 and a molecular weight of 345.09 g/mol. Its IUPAC name is 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-5-(trifluoromethyl)quinoline.
| Compound Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-5-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 157109365 |
| Molecular Formula | C17H11BF3NO3 |
| Molecular Weight | 345.09 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-5-(trifluoromethyl)quinoline |
| SMILES | OB1OCc2cc(Oc3ccc4c(C(F)(F)F)cccc4n3)ccc21 |
| InChI | InChI=1S/C17H11BF3NO3/c19-17(20,21)13-2-1-3-15-12(13)5-7-16(22-15)25-11-4-6-14-10(8-11)9-24-18(14)23/h1-8,23H,9H2 |
| InChIKey | AGQXQRFBPLVJPU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.09 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|