C19H14BClN2O4 — CID 139014775
6-(4-chlorophenoxy)-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)pyridine-2-carboxamide (PubChem CID 139014775) has the molecular formula C19H14BClN2O4 and a molecular weight of 380.60 g/mol. Its IUPAC name is 6-(4-chlorophenoxy)-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)pyridine-2-carboxamide.
| Compound Name | 6-(4-chlorophenoxy)-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139014775 |
| Molecular Formula | C19H14BClN2O4 |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 6-(4-chlorophenoxy)-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)COB2O)c1cccc(Oc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H14BClN2O4/c21-13-4-7-15(8-5-13)27-18-3-1-2-17(23-18)19(24)22-14-6-9-16-12(10-14)11-26-20(16)25/h1-10,25H,11H2,(H,22,24) |
| InChIKey | YGMQGMJHUYIGIP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|